C8H15NO3S — CID 103848673
N-[(3-hydroxyoxolan-3-yl)methyl]-2-methylsulfanylacetamide (PubChem CID 103848673) has the molecular formula C8H15NO3S and a molecular weight of 205.28 g/mol. Its IUPAC name is N-[(3-hydroxyoxolan-3-yl)methyl]-2-methylsulfanylacetamide.
| Compound Name | N-[(3-hydroxyoxolan-3-yl)methyl]-2-methylsulfanylacetamide |
|---|---|
| PubChem CID | 103848673 |
| Molecular Formula | C8H15NO3S |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.08 |
| IUPAC Name | N-[(3-hydroxyoxolan-3-yl)methyl]-2-methylsulfanylacetamide |
| SMILES | CSCC(=O)NCC1(O)CCOC1 |
| InChI | InChI=1S/C8H15NO3S/c1-13-4-7(10)9-5-8(11)2-3-12-6-8/h11H,2-6H2,1H3,(H,9,10) |
| InChIKey | NNZXNTKRDRUSOR-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |