C10H19NO3S — CID 103848866
N-[(3-hydroxyoxolan-3-yl)methyl]-2-propan-2-ylsulfanylacetamide (PubChem CID 103848866) has the molecular formula C10H19NO3S and a molecular weight of 233.33 g/mol. Its IUPAC name is N-[(3-hydroxyoxolan-3-yl)methyl]-2-propan-2-ylsulfanylacetamide.
| Compound Name | N-[(3-hydroxyoxolan-3-yl)methyl]-2-propan-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 103848866 |
| Molecular Formula | C10H19NO3S |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | N-[(3-hydroxyoxolan-3-yl)methyl]-2-propan-2-ylsulfanylacetamide |
| SMILES | CC(C)SCC(=O)NCC1(O)CCOC1 |
| InChI | InChI=1S/C10H19NO3S/c1-8(2)15-5-9(12)11-6-10(13)3-4-14-7-10/h8,13H,3-7H2,1-2H3,(H,11,12) |
| InChIKey | HQMILVIIWVJOPT-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |