C8H16N2O3 — CID 106101394
2-amino-N-[(3-hydroxyoxolan-3-yl)methyl]propanamide (PubChem CID 106101394) has the molecular formula C8H16N2O3 and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-amino-N-[(3-hydroxyoxolan-3-yl)methyl]propanamide.
| Compound Name | 2-amino-N-[(3-hydroxyoxolan-3-yl)methyl]propanamide |
|---|---|
| PubChem CID | 106101394 |
| Molecular Formula | C8H16N2O3 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 2-amino-N-[(3-hydroxyoxolan-3-yl)methyl]propanamide |
| SMILES | CC(N)C(=O)NCC1(O)CCOC1 |
| InChI | InChI=1S/C8H16N2O3/c1-6(9)7(11)10-4-8(12)2-3-13-5-8/h6,12H,2-5,9H2,1H3,(H,10,11) |
| InChIKey | VCDVEJSHMJBSDO-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |