C11H22N2O3 — CID 106101365
2-amino-N-[(3-hydroxyoxolan-3-yl)methyl]hexanamide (PubChem CID 106101365) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-amino-N-[(3-hydroxyoxolan-3-yl)methyl]hexanamide.
| Compound Name | 2-amino-N-[(3-hydroxyoxolan-3-yl)methyl]hexanamide |
|---|---|
| PubChem CID | 106101365 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | 2-amino-N-[(3-hydroxyoxolan-3-yl)methyl]hexanamide |
| SMILES | CCCCC(N)C(=O)NCC1(O)CCOC1 |
| InChI | InChI=1S/C11H22N2O3/c1-2-3-4-9(12)10(14)13-7-11(15)5-6-16-8-11/h9,15H,2-8,12H2,1H3,(H,13,14) |
| InChIKey | QCOOSPVXVQMSOU-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |