C11H20N2O3 — CID 106101542
3-amino-3-cyclopropyl-N-[(3-hydroxyoxolan-3-yl)methyl]propanamide (PubChem CID 106101542) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is 3-amino-3-cyclopropyl-N-[(3-hydroxyoxolan-3-yl)methyl]propanamide.
| Compound Name | 3-amino-3-cyclopropyl-N-[(3-hydroxyoxolan-3-yl)methyl]propanamide |
|---|---|
| PubChem CID | 106101542 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 3-amino-3-cyclopropyl-N-[(3-hydroxyoxolan-3-yl)methyl]propanamide |
| SMILES | NC(CC(=O)NCC1(O)CCOC1)C1CC1 |
| InChI | InChI=1S/C11H20N2O3/c12-9(8-1-2-8)5-10(14)13-6-11(15)3-4-16-7-11/h8-9,15H,1-7,12H2,(H,13,14) |
| InChIKey | XORHHCULDZRRSK-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |