C21H24N6O — CID 10384909
5-[(E)-4-azidobut-2-enyl]-1,3-dibenzyl-1,3,5-triazinan-2-one (PubChem CID 10384909) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is 5-[(E)-4-azidobut-2-enyl]-1,3-dibenzyl-1,3,5-triazinan-2-one.
| Compound Name | 5-[(E)-4-azidobut-2-enyl]-1,3-dibenzyl-1,3,5-triazinan-2-one |
|---|---|
| PubChem CID | 10384909 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 5-[(E)-4-azidobut-2-enyl]-1,3-dibenzyl-1,3,5-triazinan-2-one |
| SMILES | [N-]=[N+]=NC/C=C/CN1CN(Cc2ccccc2)C(=O)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C21H24N6O/c22-24-23-13-7-8-14-25-17-26(15-19-9-3-1-4-10-19)21(28)27(18-25)16-20-11-5-2-6-12-20/h1-12H,13-18H2/b8-7+ |
| InChIKey | YNKLRMBRKVBTSE-BQYQJAHWSA-N |
| XLogP | 4.21 |
| TPSA | 75.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|