C21H25N3O2 — CID 10360602
4-(3,5-dibenzyl-4-oxo-1,3,5-triazinan-1-yl)butanal (PubChem CID 10360602) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 4-(3,5-dibenzyl-4-oxo-1,3,5-triazinan-1-yl)butanal.
| Compound Name | 4-(3,5-dibenzyl-4-oxo-1,3,5-triazinan-1-yl)butanal |
|---|---|
| PubChem CID | 10360602 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 4-(3,5-dibenzyl-4-oxo-1,3,5-triazinan-1-yl)butanal |
| SMILES | O=CCCCN1CN(Cc2ccccc2)C(=O)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C21H25N3O2/c25-14-8-7-13-22-17-23(15-19-9-3-1-4-10-19)21(26)24(18-22)16-20-11-5-2-6-12-20/h1-6,9-12,14H,7-8,13,15-18H2 |
| InChIKey | VXTLHOGQUMFTGB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|