C26H22N2O2 — CID 122209546
1,3-dibenzyl-2,4-dihydrobenzo[g]quinazoline-5,10-dione (PubChem CID 122209546) has the molecular formula C26H22N2O2 and a molecular weight of 394.47 g/mol. Its IUPAC name is 1,3-dibenzyl-2,4-dihydrobenzo[g]quinazoline-5,10-dione.
| Compound Name | 1,3-dibenzyl-2,4-dihydrobenzo[g]quinazoline-5,10-dione |
|---|---|
| PubChem CID | 122209546 |
| Molecular Formula | C26H22N2O2 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 1,3-dibenzyl-2,4-dihydrobenzo[g]quinazoline-5,10-dione |
| SMILES | O=C1C2=C(C(=O)c3ccccc31)N(Cc1ccccc1)CN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C26H22N2O2/c29-25-21-13-7-8-14-22(21)26(30)24-23(25)17-27(15-19-9-3-1-4-10-19)18-28(24)16-20-11-5-2-6-12-20/h1-14H,15-18H2 |
| InChIKey | MDUHMYXLPRAANH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|