C21H21F3O3 — CID 10384980
[(1S,4R)-4-methyl-1,2,3,4-tetrahydronaphthalen-1-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 10384980) has the molecular formula C21H21F3O3 and a molecular weight of 378.39 g/mol. Its IUPAC name is [(1S,4R)-4-methyl-1,2,3,4-tetrahydronaphthalen-1-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(1S,4R)-4-methyl-1,2,3,4-tetrahydronaphthalen-1-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 10384980 |
| Molecular Formula | C21H21F3O3 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | [(1S,4R)-4-methyl-1,2,3,4-tetrahydronaphthalen-1-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CO[C@@](C(=O)O[C@H]1CC[C@@H](C)c2ccccc21)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C21H21F3O3/c1-14-12-13-18(17-11-7-6-10-16(14)17)27-19(25)20(26-2,21(22,23)24)15-8-4-3-5-9-15/h3-11,14,18H,12-13H2,1-2H3/t14-,18+,20-/m1/s1 |
| InChIKey | VGNUVNKNBAYRQZ-HEFCMCLBSA-N |
| XLogP | 5.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |