C23H37NO2Si — CID 10385570
tri(propan-2-yl)silyl (2S,3R)-1-benzyl-3-methyl-3,6-dihydro-2H-pyridine-2-carboxylate (PubChem CID 10385570) has the molecular formula C23H37NO2Si and a molecular weight of 387.64 g/mol. Its IUPAC name is tri(propan-2-yl)silyl (2S,3R)-1-benzyl-3-methyl-3,6-dihydro-2H-pyridine-2-carboxylate.
| Compound Name | tri(propan-2-yl)silyl (2S,3R)-1-benzyl-3-methyl-3,6-dihydro-2H-pyridine-2-carboxylate |
|---|---|
| PubChem CID | 10385570 |
| Molecular Formula | C23H37NO2Si |
| Molecular Weight | 387.64 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | tri(propan-2-yl)silyl (2S,3R)-1-benzyl-3-methyl-3,6-dihydro-2H-pyridine-2-carboxylate |
| SMILES | CC(C)[Si](OC(=O)[C@@H]1[C@H](C)C=CCN1Cc1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H37NO2Si/c1-17(2)27(18(3)4,19(5)6)26-23(25)22-20(7)12-11-15-24(22)16-21-13-9-8-10-14-21/h8-14,17-20,22H,15-16H2,1-7H3/t20-,22+/m1/s1 |
| InChIKey | OOVYFMWPZYHWCI-IRLDBZIGSA-N |
| XLogP | 5.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.64 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|