C9H8F7NO — CID 103856756
2,2,3,3-tetrafluoro-1-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]propan-1-one (PubChem CID 103856756) has the molecular formula C9H8F7NO and a molecular weight of 279.15 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-1-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]propan-1-one.
| Compound Name | 2,2,3,3-tetrafluoro-1-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 103856756 |
| Molecular Formula | C9H8F7NO |
| Molecular Weight | 279.15 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 2,2,3,3-tetrafluoro-1-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]propan-1-one |
| SMILES | O=C(N1CC=C(C(F)(F)F)CC1)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H8F7NO/c10-6(11)8(12,13)7(18)17-3-1-5(2-4-17)9(14,15)16/h1,6H,2-4H2 |
| InChIKey | UNISNIAVQMYHLY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.15 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|