C15H27N3O2 — CID 103862380
1-ethyl-N-(5-hydroxy-4-methylpentyl)-3-propan-2-ylpyrazole-5-carboxamide (PubChem CID 103862380) has the molecular formula C15H27N3O2 and a molecular weight of 281.40 g/mol. Its IUPAC name is 1-ethyl-N-(5-hydroxy-4-methylpentyl)-3-propan-2-ylpyrazole-5-carboxamide.
| Compound Name | 1-ethyl-N-(5-hydroxy-4-methylpentyl)-3-propan-2-ylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 103862380 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | 1-ethyl-N-(5-hydroxy-4-methylpentyl)-3-propan-2-ylpyrazole-5-carboxamide |
| SMILES | CCn1nc(C(C)C)cc1C(=O)NCCCC(C)CO |
| InChI | InChI=1S/C15H27N3O2/c1-5-18-14(9-13(17-18)11(2)3)15(20)16-8-6-7-12(4)10-19/h9,11-12,19H,5-8,10H2,1-4H3,(H,16,20) |
| InChIKey | IUPPKRITBWIGQP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|