C15H23N3O3 — CID 146099959
methyl (E)-5-[(1-ethyl-3-propan-2-ylpyrazole-5-carbonyl)amino]pent-2-enoate (PubChem CID 146099959) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is methyl (E)-5-[(1-ethyl-3-propan-2-ylpyrazole-5-carbonyl)amino]pent-2-enoate.
| Compound Name | methyl (E)-5-[(1-ethyl-3-propan-2-ylpyrazole-5-carbonyl)amino]pent-2-enoate |
|---|---|
| PubChem CID | 146099959 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | methyl (E)-5-[(1-ethyl-3-propan-2-ylpyrazole-5-carbonyl)amino]pent-2-enoate |
| SMILES | CCn1nc(C(C)C)cc1C(=O)NCC/C=C/C(=O)OC |
| InChI | InChI=1S/C15H23N3O3/c1-5-18-13(10-12(17-18)11(2)3)15(20)16-9-7-6-8-14(19)21-4/h6,8,10-11H,5,7,9H2,1-4H3,(H,16,20)/b8-6+ |
| InChIKey | QISXSHDEPMNFPW-SOFGYWHQSA-N |
| XLogP | 1.88 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|