C12H15N3O3S — CID 103865640
N-[(2,3,4-trimethoxyphenyl)methyl]-1,3,4-thiadiazol-2-amine (PubChem CID 103865640) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is N-[(2,3,4-trimethoxyphenyl)methyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N-[(2,3,4-trimethoxyphenyl)methyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 103865640 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | N-[(2,3,4-trimethoxyphenyl)methyl]-1,3,4-thiadiazol-2-amine |
| SMILES | COc1ccc(CNc2nncs2)c(OC)c1OC |
| InChI | InChI=1S/C12H15N3O3S/c1-16-9-5-4-8(10(17-2)11(9)18-3)6-13-12-15-14-7-19-12/h4-5,7H,6H2,1-3H3,(H,13,15) |
| InChIKey | HUPXFUQVOVQLEP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |