C17H19FO3 — CID 103865817
2-(4-ethyl-2-methoxyphenoxy)-1-(2-fluorophenyl)ethanol (PubChem CID 103865817) has the molecular formula C17H19FO3 and a molecular weight of 290.33 g/mol. Its IUPAC name is 2-(4-ethyl-2-methoxyphenoxy)-1-(2-fluorophenyl)ethanol.
| Compound Name | 2-(4-ethyl-2-methoxyphenoxy)-1-(2-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 103865817 |
| Molecular Formula | C17H19FO3 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 2-(4-ethyl-2-methoxyphenoxy)-1-(2-fluorophenyl)ethanol |
| SMILES | CCc1ccc(OCC(O)c2ccccc2F)c(OC)c1 |
| InChI | InChI=1S/C17H19FO3/c1-3-12-8-9-16(17(10-12)20-2)21-11-15(19)13-6-4-5-7-14(13)18/h4-10,15,19H,3,11H2,1-2H3 |
| InChIKey | KTRKKFKZPDKRPR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |