C24H29FN4O — CID 10386749
8-cyclopropyl-2-fluoro-6-[(3S)-3-(3-methoxypropyl)piperazin-1-yl]-11H-benzo[b][1,4]benzodiazepine (PubChem CID 10386749) has the molecular formula C24H29FN4O and a molecular weight of 408.52 g/mol. Its IUPAC name is 8-cyclopropyl-2-fluoro-6-[(3S)-3-(3-methoxypropyl)piperazin-1-yl]-11H-benzo[b][1,4]benzodiazepine.
| Compound Name | 8-cyclopropyl-2-fluoro-6-[(3S)-3-(3-methoxypropyl)piperazin-1-yl]-11H-benzo[b][1,4]benzodiazepine |
|---|---|
| PubChem CID | 10386749 |
| Molecular Formula | C24H29FN4O |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 8-cyclopropyl-2-fluoro-6-[(3S)-3-(3-methoxypropyl)piperazin-1-yl]-11H-benzo[b][1,4]benzodiazepine |
| SMILES | COCCC[C@H]1CN(C2=Nc3ccc(F)cc3Nc3ccc(C4CC4)cc32)CCN1 |
| InChI | InChI=1S/C24H29FN4O/c1-30-12-2-3-19-15-29(11-10-26-19)24-20-13-17(16-4-5-16)6-8-21(20)27-23-14-18(25)7-9-22(23)28-24/h6-9,13-14,16,19,26-27H,2-5,10-12,15H2,1H3/t19-/m0/s1 |
| InChIKey | NXYJUJGMVKBQPW-IBGZPJMESA-N |
| XLogP | 4.54 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|