C9H14N2O5S2 — CID 103868093
methyl 4-[(2-oxo-3H-1,3-thiazol-4-yl)methylsulfamoyl]butanoate (PubChem CID 103868093) has the molecular formula C9H14N2O5S2 and a molecular weight of 294.35 g/mol. Its IUPAC name is methyl 4-[(2-oxo-3H-1,3-thiazol-4-yl)methylsulfamoyl]butanoate.
| Compound Name | methyl 4-[(2-oxo-3H-1,3-thiazol-4-yl)methylsulfamoyl]butanoate |
|---|---|
| PubChem CID | 103868093 |
| Molecular Formula | C9H14N2O5S2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | methyl 4-[(2-oxo-3H-1,3-thiazol-4-yl)methylsulfamoyl]butanoate |
| SMILES | COC(=O)CCCS(=O)(=O)NCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C9H14N2O5S2/c1-16-8(12)3-2-4-18(14,15)10-5-7-6-17-9(13)11-7/h6,10H,2-5H2,1H3,(H,11,13) |
| InChIKey | LRDXATHEOVLYCI-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 105.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |