C8H12N2O5S2 — CID 106379597
4-[(2-oxo-3H-1,3-thiazol-4-yl)methylsulfamoyl]butanoic acid (PubChem CID 106379597) has the molecular formula C8H12N2O5S2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 4-[(2-oxo-3H-1,3-thiazol-4-yl)methylsulfamoyl]butanoic acid.
| Compound Name | 4-[(2-oxo-3H-1,3-thiazol-4-yl)methylsulfamoyl]butanoic acid |
|---|---|
| PubChem CID | 106379597 |
| Molecular Formula | C8H12N2O5S2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | 4-[(2-oxo-3H-1,3-thiazol-4-yl)methylsulfamoyl]butanoic acid |
| SMILES | O=C(O)CCCS(=O)(=O)NCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C8H12N2O5S2/c11-7(12)2-1-3-17(14,15)9-4-6-5-16-8(13)10-6/h5,9H,1-4H2,(H,10,13)(H,11,12) |
| InChIKey | WCZTTZGMTCJPMB-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |