C7H10N2O5S2 — CID 106379574
3-[(2-oxo-3H-1,3-thiazol-4-yl)methylsulfamoyl]propanoic acid (PubChem CID 106379574) has the molecular formula C7H10N2O5S2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 3-[(2-oxo-3H-1,3-thiazol-4-yl)methylsulfamoyl]propanoic acid.
| Compound Name | 3-[(2-oxo-3H-1,3-thiazol-4-yl)methylsulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 106379574 |
| Molecular Formula | C7H10N2O5S2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.00 |
| IUPAC Name | 3-[(2-oxo-3H-1,3-thiazol-4-yl)methylsulfamoyl]propanoic acid |
| SMILES | O=C(O)CCS(=O)(=O)NCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C7H10N2O5S2/c10-6(11)1-2-16(13,14)8-3-5-4-15-7(12)9-5/h4,8H,1-3H2,(H,9,12)(H,10,11) |
| InChIKey | APRCHQTWHLLKEP-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |