About 3-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide
3-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide (PubChem CID 106383784) has the molecular formula C7H12N2O4S2
and a molecular weight of 252.32 g/mol. Its IUPAC name is 3-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide.
Molecular Properties
| Compound Name | 3-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide |
| PubChem CID | 106383784 |
| Molecular Formula | C7H12N2O4S2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 3-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide |
| SMILES | O=c1[nH]c(CNS(=O)(=O)CCCO)cs1 |
| InChI | InChI=1S/C7H12N2O4S2/c10-2-1-3-15(12,13)8-4-6-5-14-7(11)9-6/h5,8,10H,1-4H2,(H,9,11) |
| InChIKey | VGCVYPZHOWTWHF-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide?
The IUPAC name of 3-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide (CID 106383784) is 3-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide.
What is the SMILES notation for 3-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide?
The canonical SMILES for 3-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide is O=c1[nH]c(CNS(=O)(=O)CCCO)cs1.
What is the InChIKey of 3-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide?
The InChIKey is VGCVYPZHOWTWHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O4S2/c10-2-1-3-15(12,13)8-4-6-5-14-7(11)9-6/h5,8,10H,1-4H2,(H,9,11).
What are the key properties of 3-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide?
3-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide has a molecular weight of 252.32 g/mol, XLogP of -0.76, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide is sourced from PubChem (CID 106383784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).