C11H13BrFNO3S — CID 103871460
1-(2-bromo-4-fluorophenyl)sulfonyl-3-methylpyrrolidin-3-ol (PubChem CID 103871460) has the molecular formula C11H13BrFNO3S and a molecular weight of 338.20 g/mol. Its IUPAC name is 1-(2-bromo-4-fluorophenyl)sulfonyl-3-methylpyrrolidin-3-ol.
| Compound Name | 1-(2-bromo-4-fluorophenyl)sulfonyl-3-methylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 103871460 |
| Molecular Formula | C11H13BrFNO3S |
| Molecular Weight | 338.20 g/mol |
| Exact Mass | 336.98 |
| IUPAC Name | 1-(2-bromo-4-fluorophenyl)sulfonyl-3-methylpyrrolidin-3-ol |
| SMILES | CC1(O)CCN(S(=O)(=O)c2ccc(F)cc2Br)C1 |
| InChI | InChI=1S/C11H13BrFNO3S/c1-11(15)4-5-14(7-11)18(16,17)10-3-2-8(13)6-9(10)12/h2-3,6,15H,4-5,7H2,1H3 |
| InChIKey | GJALUBMHLJNWKN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.20 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |