C9H19NO3S — CID 103871497
3-methyl-1-(2-methylpropylsulfonyl)pyrrolidin-3-ol (PubChem CID 103871497) has the molecular formula C9H19NO3S and a molecular weight of 221.32 g/mol. Its IUPAC name is 3-methyl-1-(2-methylpropylsulfonyl)pyrrolidin-3-ol.
| Compound Name | 3-methyl-1-(2-methylpropylsulfonyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 103871497 |
| Molecular Formula | C9H19NO3S |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 3-methyl-1-(2-methylpropylsulfonyl)pyrrolidin-3-ol |
| SMILES | CC(C)CS(=O)(=O)N1CCC(C)(O)C1 |
| InChI | InChI=1S/C9H19NO3S/c1-8(2)6-14(12,13)10-5-4-9(3,11)7-10/h8,11H,4-7H2,1-3H3 |
| InChIKey | QQKMZUZMLJNXET-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |