C14H23FN4 — CID 103879834
N-[[1-(dimethylamino)cyclopentyl]methyl]-6-ethyl-5-fluoropyrimidin-4-amine (PubChem CID 103879834) has the molecular formula C14H23FN4 and a molecular weight of 266.36 g/mol. Its IUPAC name is N-[[1-(dimethylamino)cyclopentyl]methyl]-6-ethyl-5-fluoropyrimidin-4-amine.
| Compound Name | N-[[1-(dimethylamino)cyclopentyl]methyl]-6-ethyl-5-fluoropyrimidin-4-amine |
|---|---|
| PubChem CID | 103879834 |
| Molecular Formula | C14H23FN4 |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | N-[[1-(dimethylamino)cyclopentyl]methyl]-6-ethyl-5-fluoropyrimidin-4-amine |
| SMILES | CCc1ncnc(NCC2(N(C)C)CCCC2)c1F |
| InChI | InChI=1S/C14H23FN4/c1-4-11-12(15)13(18-10-17-11)16-9-14(19(2)3)7-5-6-8-14/h10H,4-9H2,1-3H3,(H,16,17,18) |
| InChIKey | OACAKNUGRLVLQR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |