C11H15FN4O — CID 103880018
3-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]piperidin-2-one (PubChem CID 103880018) has the molecular formula C11H15FN4O and a molecular weight of 238.27 g/mol. Its IUPAC name is 3-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]piperidin-2-one.
| Compound Name | 3-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]piperidin-2-one |
|---|---|
| PubChem CID | 103880018 |
| Molecular Formula | C11H15FN4O |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 3-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]piperidin-2-one |
| SMILES | CCc1ncnc(NC2CCCNC2=O)c1F |
| InChI | InChI=1S/C11H15FN4O/c1-2-7-9(12)10(15-6-14-7)16-8-4-3-5-13-11(8)17/h6,8H,2-5H2,1H3,(H,13,17)(H,14,15,16) |
| InChIKey | MGOSMKBBLLQTMM-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |