C10H12ClN3O2S — CID 103886479
4-(6-chloro-4-nitro-2-pyridinyl)-1,4-thiazepane (PubChem CID 103886479) has the molecular formula C10H12ClN3O2S and a molecular weight of 273.74 g/mol. Its IUPAC name is 4-(6-chloro-4-nitro-2-pyridinyl)-1,4-thiazepane.
| Compound Name | 4-(6-chloro-4-nitro-2-pyridinyl)-1,4-thiazepane |
|---|---|
| PubChem CID | 103886479 |
| Molecular Formula | C10H12ClN3O2S |
| Molecular Weight | 273.74 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 4-(6-chloro-4-nitro-2-pyridinyl)-1,4-thiazepane |
| SMILES | O=[N+]([O-])c1cc(Cl)nc(N2CCCSCC2)c1 |
| InChI | InChI=1S/C10H12ClN3O2S/c11-9-6-8(14(15)16)7-10(12-9)13-2-1-4-17-5-3-13/h6-7H,1-5H2 |
| InChIKey | SPOZMOQCHZMQKG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.74 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|