C26H26N2O3S — CID 10388884
N-[[3-[(3-methoxyphenyl)methoxy]phenyl]carbamothioyl]-1,2,3,4-tetrahydronaphthalene-2-carboxamide (PubChem CID 10388884) has the molecular formula C26H26N2O3S and a molecular weight of 446.57 g/mol. Its IUPAC name is N-[[3-[(3-methoxyphenyl)methoxy]phenyl]carbamothioyl]-1,2,3,4-tetrahydronaphthalene-2-carboxamide.
| Compound Name | N-[[3-[(3-methoxyphenyl)methoxy]phenyl]carbamothioyl]-1,2,3,4-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 10388884 |
| Molecular Formula | C26H26N2O3S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | N-[[3-[(3-methoxyphenyl)methoxy]phenyl]carbamothioyl]-1,2,3,4-tetrahydronaphthalene-2-carboxamide |
| SMILES | COc1cccc(COc2cccc(NC(=S)NC(=O)C3CCc4ccccc4C3)c2)c1 |
| InChI | InChI=1S/C26H26N2O3S/c1-30-23-10-4-6-18(14-23)17-31-24-11-5-9-22(16-24)27-26(32)28-25(29)21-13-12-19-7-2-3-8-20(19)15-21/h2-11,14,16,21H,12-13,15,17H2,1H3,(H2,27,28,29,32) |
| InChIKey | VVNMJPDUCUWHQL-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|