C24H30N4O3S — CID 10389268
4-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-2-hydroxybutyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 10389268) has the molecular formula C24H30N4O3S and a molecular weight of 454.60 g/mol. Its IUPAC name is 4-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-2-hydroxybutyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | 4-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-2-hydroxybutyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 10389268 |
| Molecular Formula | C24H30N4O3S |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 4-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-2-hydroxybutyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=C1C2C3CCC(C3)C2C(=O)N1CC(O)CCN1CCN(c2nsc3ccccc23)CC1 |
| InChI | InChI=1S/C24H30N4O3S/c29-17(14-28-23(30)20-15-5-6-16(13-15)21(20)24(28)31)7-8-26-9-11-27(12-10-26)22-18-3-1-2-4-19(18)32-25-22/h1-4,15-17,20-21,29H,5-14H2 |
| InChIKey | GBEPMNFRBZKLRL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|