C24H32N4O2S — CID 10575121
(1S,2R,6S,7R)-4-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-5-hydroxy-4-azatricyclo[5.2.1.02,6]decan-3-one (PubChem CID 10575121) has the molecular formula C24H32N4O2S and a molecular weight of 440.61 g/mol. Its IUPAC name is (1S,2R,6S,7R)-4-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-5-hydroxy-4-azatricyclo[5.2.1.02,6]decan-3-one.
| Compound Name | (1S,2R,6S,7R)-4-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-5-hydroxy-4-azatricyclo[5.2.1.02,6]decan-3-one |
|---|---|
| PubChem CID | 10575121 |
| Molecular Formula | C24H32N4O2S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | (1S,2R,6S,7R)-4-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-5-hydroxy-4-azatricyclo[5.2.1.02,6]decan-3-one |
| SMILES | O=C1[C@@H]2[C@H]3CC[C@H](C3)[C@@H]2C(O)N1CCCCN1CCN(c2nsc3ccccc23)CC1 |
| InChI | InChI=1S/C24H32N4O2S/c29-23-20-16-7-8-17(15-16)21(20)24(30)28(23)10-4-3-9-26-11-13-27(14-12-26)22-18-5-1-2-6-19(18)31-25-22/h1-2,5-6,16-17,20-21,23,29H,3-4,7-15H2/t16-,17+,20+,21-,23?/m1/s1 |
| InChIKey | SINMMDOAXNEQGA-SUMWLKOHSA-N |
| XLogP | 3.02 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|