C25H32N4O2S — CID 11797924
(1S,2R,6S,7R)-4-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]pentyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 11797924) has the molecular formula C25H32N4O2S and a molecular weight of 452.62 g/mol. Its IUPAC name is (1S,2R,6S,7R)-4-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]pentyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1S,2R,6S,7R)-4-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]pentyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 11797924 |
| Molecular Formula | C25H32N4O2S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | (1S,2R,6S,7R)-4-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]pentyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | CC(CCCN1C(=O)[C@@H]2[C@H]3CC[C@H](C3)[C@@H]2C1=O)N1CCN(c2nsc3ccccc23)CC1 |
| InChI | InChI=1S/C25H32N4O2S/c1-16(5-4-10-29-24(30)21-17-8-9-18(15-17)22(21)25(29)31)27-11-13-28(14-12-27)23-19-6-2-3-7-20(19)32-26-23/h2-3,6-7,16-18,21-22H,4-5,8-15H2,1H3/t16?,17-,18+,21+,22- |
| InChIKey | KUKWRAOKVRXHIV-GXMKGZLNSA-N |
| XLogP | 3.62 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|