About 5-bromo-N-(3-hydroxy-2,3-dimethylbutan-2-yl)thiophene-2-carboxamide
5-bromo-N-(3-hydroxy-2,3-dimethylbutan-2-yl)thiophene-2-carboxamide (PubChem CID 103895550) has the molecular formula C11H16BrNO2S
and a molecular weight of 306.23 g/mol. Its IUPAC name is 5-bromo-N-(3-hydroxy-2,3-dimethylbutan-2-yl)thiophene-2-carboxamide.
Molecular Properties
| Compound Name | 5-bromo-N-(3-hydroxy-2,3-dimethylbutan-2-yl)thiophene-2-carboxamide |
| PubChem CID | 103895550 |
| Molecular Formula | C11H16BrNO2S |
| Molecular Weight | 306.23 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 5-bromo-N-(3-hydroxy-2,3-dimethylbutan-2-yl)thiophene-2-carboxamide |
| SMILES | CC(C)(O)C(C)(C)NC(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C11H16BrNO2S/c1-10(2,11(3,4)15)13-9(14)7-5-6-8(12)16-7/h5-6,15H,1-4H3,(H,13,14) |
| InChIKey | NJYXFXBFFDZQFX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.23 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-N-(3-hydroxy-2,3-dimethylbutan-2-yl)thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-(3-hydroxy-2,3-dimethylbutan-2-yl)thiophene-2-carboxamide?
The IUPAC name of 5-bromo-N-(3-hydroxy-2,3-dimethylbutan-2-yl)thiophene-2-carboxamide (CID 103895550) is 5-bromo-N-(3-hydroxy-2,3-dimethylbutan-2-yl)thiophene-2-carboxamide.
What is the SMILES notation for 5-bromo-N-(3-hydroxy-2,3-dimethylbutan-2-yl)thiophene-2-carboxamide?
The canonical SMILES for 5-bromo-N-(3-hydroxy-2,3-dimethylbutan-2-yl)thiophene-2-carboxamide is CC(C)(O)C(C)(C)NC(=O)c1ccc(Br)s1.
What is the InChIKey of 5-bromo-N-(3-hydroxy-2,3-dimethylbutan-2-yl)thiophene-2-carboxamide?
The InChIKey is NJYXFXBFFDZQFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16BrNO2S/c1-10(2,11(3,4)15)13-9(14)7-5-6-8(12)16-7/h5-6,15H,1-4H3,(H,13,14).
What are the key properties of 5-bromo-N-(3-hydroxy-2,3-dimethylbutan-2-yl)thiophene-2-carboxamide?
5-bromo-N-(3-hydroxy-2,3-dimethylbutan-2-yl)thiophene-2-carboxamide has a molecular weight of 306.23 g/mol, XLogP of 2.79, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-(3-hydroxy-2,3-dimethylbutan-2-yl)thiophene-2-carboxamide is sourced from PubChem (CID 103895550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).