About 4-ethyl-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-5-methylthiophene-2-carboxamide
4-ethyl-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-5-methylthiophene-2-carboxamide (PubChem CID 103933173) has the molecular formula C14H23NO2S
and a molecular weight of 269.41 g/mol. Its IUPAC name is 4-ethyl-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-5-methylthiophene-2-carboxamide.
Molecular Properties
| Compound Name | 4-ethyl-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-5-methylthiophene-2-carboxamide |
| PubChem CID | 103933173 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 4-ethyl-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-5-methylthiophene-2-carboxamide |
| SMILES | CCc1cc(C(=O)NC(C)(C)C(C)(C)O)sc1C |
| InChI | InChI=1S/C14H23NO2S/c1-7-10-8-11(18-9(10)2)12(16)15-13(3,4)14(5,6)17/h8,17H,7H2,1-6H3,(H,15,16) |
| InChIKey | ADADURDJYNBBPJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethyl-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-5-methylthiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-5-methylthiophene-2-carboxamide?
The IUPAC name of 4-ethyl-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-5-methylthiophene-2-carboxamide (CID 103933173) is 4-ethyl-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-5-methylthiophene-2-carboxamide.
What is the SMILES notation for 4-ethyl-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-5-methylthiophene-2-carboxamide?
The canonical SMILES for 4-ethyl-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-5-methylthiophene-2-carboxamide is CCc1cc(C(=O)NC(C)(C)C(C)(C)O)sc1C.
What is the InChIKey of 4-ethyl-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-5-methylthiophene-2-carboxamide?
The InChIKey is ADADURDJYNBBPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO2S/c1-7-10-8-11(18-9(10)2)12(16)15-13(3,4)14(5,6)17/h8,17H,7H2,1-6H3,(H,15,16).
What are the key properties of 4-ethyl-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-5-methylthiophene-2-carboxamide?
4-ethyl-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-5-methylthiophene-2-carboxamide has a molecular weight of 269.41 g/mol, XLogP of 2.90, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-5-methylthiophene-2-carboxamide is sourced from PubChem (CID 103933173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).