About 4-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)-5-methylthiophene-2-carboxamide
4-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)-5-methylthiophene-2-carboxamide (PubChem CID 103899429) has the molecular formula C15H25NO2S
and a molecular weight of 283.44 g/mol. Its IUPAC name is 4-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)-5-methylthiophene-2-carboxamide.
Molecular Properties
| Compound Name | 4-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)-5-methylthiophene-2-carboxamide |
| PubChem CID | 103899429 |
| Molecular Formula | C15H25NO2S |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 4-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)-5-methylthiophene-2-carboxamide |
| SMILES | CCc1cc(C(=O)NCC(C)(C)CCCO)sc1C |
| InChI | InChI=1S/C15H25NO2S/c1-5-12-9-13(19-11(12)2)14(18)16-10-15(3,4)7-6-8-17/h9,17H,5-8,10H2,1-4H3,(H,16,18) |
| InChIKey | YUGFKJNKTNFKFR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)-5-methylthiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)-5-methylthiophene-2-carboxamide?
The IUPAC name of 4-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)-5-methylthiophene-2-carboxamide (CID 103899429) is 4-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)-5-methylthiophene-2-carboxamide.
What is the SMILES notation for 4-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)-5-methylthiophene-2-carboxamide?
The canonical SMILES for 4-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)-5-methylthiophene-2-carboxamide is CCc1cc(C(=O)NCC(C)(C)CCCO)sc1C.
What is the InChIKey of 4-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)-5-methylthiophene-2-carboxamide?
The InChIKey is YUGFKJNKTNFKFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO2S/c1-5-12-9-13(19-11(12)2)14(18)16-10-15(3,4)7-6-8-17/h9,17H,5-8,10H2,1-4H3,(H,16,18).
What are the key properties of 4-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)-5-methylthiophene-2-carboxamide?
4-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)-5-methylthiophene-2-carboxamide has a molecular weight of 283.44 g/mol, XLogP of 3.15, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)-5-methylthiophene-2-carboxamide is sourced from PubChem (CID 103899429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).