C9H12BrNO3S — CID 140598923
1-(5-bromothiophen-2-yl)-2-(1,1-dihydroxyethylamino)propan-1-one (PubChem CID 140598923) has the molecular formula C9H12BrNO3S and a molecular weight of 294.17 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)-2-(1,1-dihydroxyethylamino)propan-1-one.
| Compound Name | 1-(5-bromothiophen-2-yl)-2-(1,1-dihydroxyethylamino)propan-1-one |
|---|---|
| PubChem CID | 140598923 |
| Molecular Formula | C9H12BrNO3S |
| Molecular Weight | 294.17 g/mol |
| Exact Mass | 292.97 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)-2-(1,1-dihydroxyethylamino)propan-1-one |
| SMILES | CC(NC(C)(O)O)C(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C9H12BrNO3S/c1-5(11-9(2,13)14)8(12)6-3-4-7(10)15-6/h3-5,11,13-14H,1-2H3 |
| InChIKey | MKLNVEJAICXKKF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.17 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|