C8H12N2O3S — CID 140598896
2-(1,1-dihydroxyethylamino)-1-(1,3-thiazol-2-yl)propan-1-one (PubChem CID 140598896) has the molecular formula C8H12N2O3S and a molecular weight of 216.26 g/mol. Its IUPAC name is 2-(1,1-dihydroxyethylamino)-1-(1,3-thiazol-2-yl)propan-1-one.
| Compound Name | 2-(1,1-dihydroxyethylamino)-1-(1,3-thiazol-2-yl)propan-1-one |
|---|---|
| PubChem CID | 140598896 |
| Molecular Formula | C8H12N2O3S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 2-(1,1-dihydroxyethylamino)-1-(1,3-thiazol-2-yl)propan-1-one |
| SMILES | CC(NC(C)(O)O)C(=O)c1nccs1 |
| InChI | InChI=1S/C8H12N2O3S/c1-5(10-8(2,12)13)6(11)7-9-3-4-14-7/h3-5,10,12-13H,1-2H3 |
| InChIKey | CKEHAHZSKSSJPJ-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|