C13H25NO2 — CID 103899350
(Z)-N-(5-hydroxy-2,2-dimethylpentyl)-2-methylpent-2-enamide (PubChem CID 103899350) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is (Z)-N-(5-hydroxy-2,2-dimethylpentyl)-2-methylpent-2-enamide.
| Compound Name | (Z)-N-(5-hydroxy-2,2-dimethylpentyl)-2-methylpent-2-enamide |
|---|---|
| PubChem CID | 103899350 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | (Z)-N-(5-hydroxy-2,2-dimethylpentyl)-2-methylpent-2-enamide |
| SMILES | CC/C=C(/C)C(=O)NCC(C)(C)CCCO |
| InChI | InChI=1S/C13H25NO2/c1-5-7-11(2)12(16)14-10-13(3,4)8-6-9-15/h7,15H,5-6,8-10H2,1-4H3,(H,14,16)/b11-7- |
| InChIKey | ODTAZGGGLUWDAT-XFFZJAGNSA-N |
| XLogP | 2.26 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|