C13H16Br2N2O2 — CID 103907463
3,5-dibromo-N-[2-(tert-butylamino)-2-oxoethyl]benzamide (PubChem CID 103907463) has the molecular formula C13H16Br2N2O2 and a molecular weight of 392.09 g/mol. Its IUPAC name is 3,5-dibromo-N-[2-(tert-butylamino)-2-oxoethyl]benzamide.
| Compound Name | 3,5-dibromo-N-[2-(tert-butylamino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 103907463 |
| Molecular Formula | C13H16Br2N2O2 |
| Molecular Weight | 392.09 g/mol |
| Exact Mass | 389.96 |
| IUPAC Name | 3,5-dibromo-N-[2-(tert-butylamino)-2-oxoethyl]benzamide |
| SMILES | CC(C)(C)NC(=O)CNC(=O)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C13H16Br2N2O2/c1-13(2,3)17-11(18)7-16-12(19)8-4-9(14)6-10(15)5-8/h4-6H,7H2,1-3H3,(H,16,19)(H,17,18) |
| InChIKey | WXWQFNZBSNSTHB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.09 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |