C14H28I2OSi — CID 10391014
tert-butyl-[(E)-5,6-diiodo-2,2-dimethylhex-4-en-3-yl]oxy-dimethylsilane (PubChem CID 10391014) has the molecular formula C14H28I2OSi and a molecular weight of 494.27 g/mol. Its IUPAC name is tert-butyl-[(E)-5,6-diiodo-2,2-dimethylhex-4-en-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E)-5,6-diiodo-2,2-dimethylhex-4-en-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 10391014 |
| Molecular Formula | C14H28I2OSi |
| Molecular Weight | 494.27 g/mol |
| Exact Mass | 494.00 |
| IUPAC Name | tert-butyl-[(E)-5,6-diiodo-2,2-dimethylhex-4-en-3-yl]oxy-dimethylsilane |
| SMILES | CC(C)(C)C(/C=C(/I)CI)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H28I2OSi/c1-13(2,3)12(9-11(16)10-15)17-18(7,8)14(4,5)6/h9,12H,10H2,1-8H3/b11-9+ |
| InChIKey | JSPIDWGKTIUTRN-PKNBQFBNSA-N |
| XLogP | 6.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.27 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|