C16H31IOSi — CID 134890597
tert-butyl-[(2E)-3-iodo-5,5-dimethylocta-2,7-dienoxy]-dimethylsilane (PubChem CID 134890597) has the molecular formula C16H31IOSi and a molecular weight of 394.41 g/mol. Its IUPAC name is tert-butyl-[(2E)-3-iodo-5,5-dimethylocta-2,7-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2E)-3-iodo-5,5-dimethylocta-2,7-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134890597 |
| Molecular Formula | C16H31IOSi |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | tert-butyl-[(2E)-3-iodo-5,5-dimethylocta-2,7-dienoxy]-dimethylsilane |
| SMILES | C=CCC(C)(C)C/C(I)=C\CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H31IOSi/c1-9-11-16(5,6)13-14(17)10-12-18-19(7,8)15(2,3)4/h9-10H,1,11-13H2,2-8H3/b14-10+ |
| InChIKey | HZQTUQAHOIKVTC-GXDHUFHOSA-N |
| XLogP | 6.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|