C14H29IOSi — CID 10546977
tert-butyl-[(Z)-6-iodo-3,4-dimethylhex-2-enoxy]-dimethylsilane (PubChem CID 10546977) has the molecular formula C14H29IOSi and a molecular weight of 368.38 g/mol. Its IUPAC name is tert-butyl-[(Z)-6-iodo-3,4-dimethylhex-2-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(Z)-6-iodo-3,4-dimethylhex-2-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10546977 |
| Molecular Formula | C14H29IOSi |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | tert-butyl-[(Z)-6-iodo-3,4-dimethylhex-2-enoxy]-dimethylsilane |
| SMILES | C/C(=C/CO[Si](C)(C)C(C)(C)C)C(C)CCI |
| InChI | InChI=1S/C14H29IOSi/c1-12(8-10-15)13(2)9-11-16-17(6,7)14(3,4)5/h9,12H,8,10-11H2,1-7H3/b13-9- |
| InChIKey | LPUDMMGNIKOYLH-LCYFTJDESA-N |
| XLogP | 5.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|