C16H18BrN3S — CID 103910469
N-[2-(5-bromothiophen-2-yl)ethyl]-1-(1-methylbenzimidazol-2-yl)ethanamine (PubChem CID 103910469) has the molecular formula C16H18BrN3S and a molecular weight of 364.31 g/mol. Its IUPAC name is N-[2-(5-bromothiophen-2-yl)ethyl]-1-(1-methylbenzimidazol-2-yl)ethanamine.
| Compound Name | N-[2-(5-bromothiophen-2-yl)ethyl]-1-(1-methylbenzimidazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 103910469 |
| Molecular Formula | C16H18BrN3S |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | N-[2-(5-bromothiophen-2-yl)ethyl]-1-(1-methylbenzimidazol-2-yl)ethanamine |
| SMILES | CC(NCCc1ccc(Br)s1)c1nc2ccccc2n1C |
| InChI | InChI=1S/C16H18BrN3S/c1-11(18-10-9-12-7-8-15(17)21-12)16-19-13-5-3-4-6-14(13)20(16)2/h3-8,11,18H,9-10H2,1-2H3 |
| InChIKey | KYCGMOVFHUPHAM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |