C15H19N3O2 — CID 103911659
2-(furo[3,2-c]pyridin-4-ylamino)-1-piperidin-1-ylpropan-1-one (PubChem CID 103911659) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 2-(furo[3,2-c]pyridin-4-ylamino)-1-piperidin-1-ylpropan-1-one.
| Compound Name | 2-(furo[3,2-c]pyridin-4-ylamino)-1-piperidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 103911659 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 2-(furo[3,2-c]pyridin-4-ylamino)-1-piperidin-1-ylpropan-1-one |
| SMILES | CC(Nc1nccc2occc12)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C15H19N3O2/c1-11(15(19)18-8-3-2-4-9-18)17-14-12-6-10-20-13(12)5-7-16-14/h5-7,10-11H,2-4,8-9H2,1H3,(H,16,17) |
| InChIKey | NKAHPTBGCGZRPN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |