C17H29N3O3 — CID 103916001
tert-butyl 4-(3-imidazol-1-ylpropoxy)-4-methylpiperidine-1-carboxylate (PubChem CID 103916001) has the molecular formula C17H29N3O3 and a molecular weight of 323.44 g/mol. Its IUPAC name is tert-butyl 4-(3-imidazol-1-ylpropoxy)-4-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(3-imidazol-1-ylpropoxy)-4-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 103916001 |
| Molecular Formula | C17H29N3O3 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | tert-butyl 4-(3-imidazol-1-ylpropoxy)-4-methylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C)(OCCCn2ccnc2)CC1 |
| InChI | InChI=1S/C17H29N3O3/c1-16(2,3)23-15(21)20-10-6-17(4,7-11-20)22-13-5-9-19-12-8-18-14-19/h8,12,14H,5-7,9-11,13H2,1-4H3 |
| InChIKey | UUXHBQPHUISXPE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|