C16H27N3O3 — CID 103916252
tert-butyl 3-methyl-3-[2-(2-methylimidazol-1-yl)ethoxy]pyrrolidine-1-carboxylate (PubChem CID 103916252) has the molecular formula C16H27N3O3 and a molecular weight of 309.41 g/mol. Its IUPAC name is tert-butyl 3-methyl-3-[2-(2-methylimidazol-1-yl)ethoxy]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-methyl-3-[2-(2-methylimidazol-1-yl)ethoxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 103916252 |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | tert-butyl 3-methyl-3-[2-(2-methylimidazol-1-yl)ethoxy]pyrrolidine-1-carboxylate |
| SMILES | Cc1nccn1CCOC1(C)CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H27N3O3/c1-13-17-7-9-18(13)10-11-21-16(5)6-8-19(12-16)14(20)22-15(2,3)4/h7,9H,6,8,10-12H2,1-5H3 |
| InChIKey | HACVCWIJUILRKW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |