C15H25N3O3 — CID 83206642
tert-butyl 3-methyl-3-[(1-methylpyrazol-4-yl)methoxy]pyrrolidine-1-carboxylate (PubChem CID 83206642) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is tert-butyl 3-methyl-3-[(1-methylpyrazol-4-yl)methoxy]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-methyl-3-[(1-methylpyrazol-4-yl)methoxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 83206642 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | tert-butyl 3-methyl-3-[(1-methylpyrazol-4-yl)methoxy]pyrrolidine-1-carboxylate |
| SMILES | Cn1cc(COC2(C)CCN(C(=O)OC(C)(C)C)C2)cn1 |
| InChI | InChI=1S/C15H25N3O3/c1-14(2,3)21-13(19)18-7-6-15(4,11-18)20-10-12-8-16-17(5)9-12/h8-9H,6-7,10-11H2,1-5H3 |
| InChIKey | UMRWCEHGCGQLHR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |