C16H30N2O4 — CID 103916206
tert-butyl 3-[2-(tert-butylamino)-2-oxoethoxy]-3-methylpyrrolidine-1-carboxylate (PubChem CID 103916206) has the molecular formula C16H30N2O4 and a molecular weight of 314.43 g/mol. Its IUPAC name is tert-butyl 3-[2-(tert-butylamino)-2-oxoethoxy]-3-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-(tert-butylamino)-2-oxoethoxy]-3-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 103916206 |
| Molecular Formula | C16H30N2O4 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | tert-butyl 3-[2-(tert-butylamino)-2-oxoethoxy]-3-methylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)NC(=O)COC1(C)CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H30N2O4/c1-14(2,3)17-12(19)10-21-16(7)8-9-18(11-16)13(20)22-15(4,5)6/h8-11H2,1-7H3,(H,17,19) |
| InChIKey | WFENFFBFCLUEFR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |