C13H23N5O3 — CID 107044470
tert-butyl 3-methyl-3-[(2-methyltetrazol-5-yl)methoxy]pyrrolidine-1-carboxylate (PubChem CID 107044470) has the molecular formula C13H23N5O3 and a molecular weight of 297.36 g/mol. Its IUPAC name is tert-butyl 3-methyl-3-[(2-methyltetrazol-5-yl)methoxy]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-methyl-3-[(2-methyltetrazol-5-yl)methoxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 107044470 |
| Molecular Formula | C13H23N5O3 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | tert-butyl 3-methyl-3-[(2-methyltetrazol-5-yl)methoxy]pyrrolidine-1-carboxylate |
| SMILES | Cn1nnc(COC2(C)CCN(C(=O)OC(C)(C)C)C2)n1 |
| InChI | InChI=1S/C13H23N5O3/c1-12(2,3)21-11(19)18-7-6-13(4,9-18)20-8-10-14-16-17(5)15-10/h6-9H2,1-5H3 |
| InChIKey | YENSEPOJRPSGNF-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 82.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |