C8H8ClN3 — CID 103918065
N-but-2-ynyl-2-chloropyrimidin-4-amine (PubChem CID 103918065) has the molecular formula C8H8ClN3 and a molecular weight of 181.63 g/mol. Its IUPAC name is N-but-2-ynyl-2-chloropyrimidin-4-amine.
| Compound Name | N-but-2-ynyl-2-chloropyrimidin-4-amine |
|---|---|
| PubChem CID | 103918065 |
| Molecular Formula | C8H8ClN3 |
| Molecular Weight | 181.63 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | N-but-2-ynyl-2-chloropyrimidin-4-amine |
| SMILES | CC#CCNc1ccnc(Cl)n1 |
| InChI | InChI=1S/C8H8ClN3/c1-2-3-5-10-7-4-6-11-8(9)12-7/h4,6H,5H2,1H3,(H,10,11,12) |
| InChIKey | WCCJRBJAWYKESH-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.63 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|