C9H14ClN3S — CID 115695390
2-chloro-N-(4-methylsulfanylbutyl)pyrimidin-4-amine (PubChem CID 115695390) has the molecular formula C9H14ClN3S and a molecular weight of 231.75 g/mol. Its IUPAC name is 2-chloro-N-(4-methylsulfanylbutyl)pyrimidin-4-amine.
| Compound Name | 2-chloro-N-(4-methylsulfanylbutyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 115695390 |
| Molecular Formula | C9H14ClN3S |
| Molecular Weight | 231.75 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 2-chloro-N-(4-methylsulfanylbutyl)pyrimidin-4-amine |
| SMILES | CSCCCCNc1ccnc(Cl)n1 |
| InChI | InChI=1S/C9H14ClN3S/c1-14-7-3-2-5-11-8-4-6-12-9(10)13-8/h4,6H,2-3,5,7H2,1H3,(H,11,12,13) |
| InChIKey | DZDKFIDKGFYOKZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.75 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|