About methyl 3-[[(4-ethyl-1,2,4-triazol-3-yl)methylamino]methyl]furan-2-carboxylate
methyl 3-[[(4-ethyl-1,2,4-triazol-3-yl)methylamino]methyl]furan-2-carboxylate (PubChem CID 103920442) has the molecular formula C12H16N4O3
and a molecular weight of 264.28 g/mol. Its IUPAC name is methyl 3-[[(4-ethyl-1,2,4-triazol-3-yl)methylamino]methyl]furan-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-[[(4-ethyl-1,2,4-triazol-3-yl)methylamino]methyl]furan-2-carboxylate |
| PubChem CID | 103920442 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | methyl 3-[[(4-ethyl-1,2,4-triazol-3-yl)methylamino]methyl]furan-2-carboxylate |
| SMILES | CCn1cnnc1CNCc1ccoc1C(=O)OC |
| InChI | InChI=1S/C12H16N4O3/c1-3-16-8-14-15-10(16)7-13-6-9-4-5-19-11(9)12(17)18-2/h4-5,8,13H,3,6-7H2,1-2H3 |
| InChIKey | ZUTHKCMFFHCSOX-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 3-[[(4-ethyl-1,2,4-triazol-3-yl)methylamino]methyl]furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[[(4-ethyl-1,2,4-triazol-3-yl)methylamino]methyl]furan-2-carboxylate?
The IUPAC name of methyl 3-[[(4-ethyl-1,2,4-triazol-3-yl)methylamino]methyl]furan-2-carboxylate (CID 103920442) is methyl 3-[[(4-ethyl-1,2,4-triazol-3-yl)methylamino]methyl]furan-2-carboxylate.
What is the SMILES notation for methyl 3-[[(4-ethyl-1,2,4-triazol-3-yl)methylamino]methyl]furan-2-carboxylate?
The canonical SMILES for methyl 3-[[(4-ethyl-1,2,4-triazol-3-yl)methylamino]methyl]furan-2-carboxylate is CCn1cnnc1CNCc1ccoc1C(=O)OC.
What is the InChIKey of methyl 3-[[(4-ethyl-1,2,4-triazol-3-yl)methylamino]methyl]furan-2-carboxylate?
The InChIKey is ZUTHKCMFFHCSOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O3/c1-3-16-8-14-15-10(16)7-13-6-9-4-5-19-11(9)12(17)18-2/h4-5,8,13H,3,6-7H2,1-2H3.
What are the key properties of methyl 3-[[(4-ethyl-1,2,4-triazol-3-yl)methylamino]methyl]furan-2-carboxylate?
methyl 3-[[(4-ethyl-1,2,4-triazol-3-yl)methylamino]methyl]furan-2-carboxylate has a molecular weight of 264.28 g/mol, XLogP of 0.97, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[[(4-ethyl-1,2,4-triazol-3-yl)methylamino]methyl]furan-2-carboxylate is sourced from PubChem (CID 103920442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).