C10H19NO2 — CID 103924414
(2R)-2-(3,6-dihydro-2H-pyran-5-ylmethylamino)butan-1-ol (PubChem CID 103924414) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is (2R)-2-(3,6-dihydro-2H-pyran-5-ylmethylamino)butan-1-ol.
| Compound Name | (2R)-2-(3,6-dihydro-2H-pyran-5-ylmethylamino)butan-1-ol |
|---|---|
| PubChem CID | 103924414 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | (2R)-2-(3,6-dihydro-2H-pyran-5-ylmethylamino)butan-1-ol |
| SMILES | CC[C@H](CO)NCC1=CCCOC1 |
| InChI | InChI=1S/C10H19NO2/c1-2-10(7-12)11-6-9-4-3-5-13-8-9/h4,10-12H,2-3,5-8H2,1H3/t10-/m1/s1 |
| InChIKey | NERMSVXJDAISQC-SNVBAGLBSA-N |
| XLogP | 0.69 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|